C12H17Cl2N — CID 81014897
4-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-amine (PubChem CID 81014897) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81014897 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2,3-dimethylbutan-1-amine |
| SMILES | CC(CN)C(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2N/c1-8(9(2)7-15)5-10-3-4-11(13)12(14)6-10/h3-4,6,8-9H,5,7,15H2,1-2H3 |
| InChIKey | ZVBLQOMLDZYVDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |