C10H14Cl3N — CID 170888463
1-(3,4-dichlorophenyl)butan-2-amine;hydrochloride (PubChem CID 170888463) has the molecular formula C10H14Cl3N and a molecular weight of 254.59 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)butan-2-amine;hydrochloride.
| Compound Name | 1-(3,4-dichlorophenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170888463 |
| Molecular Formula | C10H14Cl3N |
| Molecular Weight | 254.59 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C10H13Cl2N.ClH/c1-2-8(13)5-7-3-4-9(11)10(12)6-7;/h3-4,6,8H,2,5,13H2,1H3;1H |
| InChIKey | WWHVHRTZKQAWBE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |