C18H21Cl2N — CID 63415619
1-(3,4-dichlorophenyl)-3-(4-propan-2-ylphenyl)propan-2-amine (PubChem CID 63415619) has the molecular formula C18H21Cl2N and a molecular weight of 322.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-propan-2-ylphenyl)propan-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-propan-2-ylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 63415619 |
| Molecular Formula | C18H21Cl2N |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-propan-2-ylphenyl)propan-2-amine |
| SMILES | CC(C)c1ccc(CC(N)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21Cl2N/c1-12(2)15-6-3-13(4-7-15)9-16(21)10-14-5-8-17(19)18(20)11-14/h3-8,11-12,16H,9-10,21H2,1-2H3 |
| InChIKey | NUROSYWRDQTLMR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |