C18H20Cl2O — CID 63428543
2-(3,4-dichlorophenyl)-1-[4-(2-methylpropyl)phenyl]ethanol (PubChem CID 63428543) has the molecular formula C18H20Cl2O and a molecular weight of 323.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[4-(2-methylpropyl)phenyl]ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[4-(2-methylpropyl)phenyl]ethanol |
|---|---|
| PubChem CID | 63428543 |
| Molecular Formula | C18H20Cl2O |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[4-(2-methylpropyl)phenyl]ethanol |
| SMILES | CC(C)Cc1ccc(C(O)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20Cl2O/c1-12(2)9-13-3-6-15(7-4-13)18(21)11-14-5-8-16(19)17(20)10-14/h3-8,10,12,18,21H,9,11H2,1-2H3 |
| InChIKey | IYEWMPYSVMYLJU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |