C18H18Cl2O — CID 116505751
1-(4-cyclobutylphenyl)-2-(3,4-dichlorophenyl)ethanol (PubChem CID 116505751) has the molecular formula C18H18Cl2O and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-(4-cyclobutylphenyl)-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-(4-cyclobutylphenyl)-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 116505751 |
| Molecular Formula | C18H18Cl2O |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1-(4-cyclobutylphenyl)-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C18H18Cl2O/c19-16-9-4-12(10-17(16)20)11-18(21)15-7-5-14(6-8-15)13-2-1-3-13/h4-10,13,18,21H,1-3,11H2 |
| InChIKey | BWGWDLIOLFDGJG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |