C12H13Cl3 — CID 63529747
1,2-dichloro-4-(2-chloro-2-cyclobutylethyl)benzene (PubChem CID 63529747) has the molecular formula C12H13Cl3 and a molecular weight of 263.59 g/mol. Its IUPAC name is 1,2-dichloro-4-(2-chloro-2-cyclobutylethyl)benzene.
| Compound Name | 1,2-dichloro-4-(2-chloro-2-cyclobutylethyl)benzene |
|---|---|
| PubChem CID | 63529747 |
| Molecular Formula | C12H13Cl3 |
| Molecular Weight | 263.59 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1,2-dichloro-4-(2-chloro-2-cyclobutylethyl)benzene |
| SMILES | Clc1ccc(CC(Cl)C2CCC2)cc1Cl |
| InChI | InChI=1S/C12H13Cl3/c13-10-5-4-8(7-12(10)15)6-11(14)9-2-1-3-9/h4-5,7,9,11H,1-3,6H2 |
| InChIKey | IBIRUSLVIBQNJM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|