C15H20Cl2O — CID 57027605
1,2-dichloro-4-(1-cyclohexylethoxymethyl)benzene (PubChem CID 57027605) has the molecular formula C15H20Cl2O and a molecular weight of 287.23 g/mol. Its IUPAC name is 1,2-dichloro-4-(1-cyclohexylethoxymethyl)benzene.
| Compound Name | 1,2-dichloro-4-(1-cyclohexylethoxymethyl)benzene |
|---|---|
| PubChem CID | 57027605 |
| Molecular Formula | C15H20Cl2O |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1,2-dichloro-4-(1-cyclohexylethoxymethyl)benzene |
| SMILES | CC(OCc1ccc(Cl)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H20Cl2O/c1-11(13-5-3-2-4-6-13)18-10-12-7-8-14(16)15(17)9-12/h7-9,11,13H,2-6,10H2,1H3 |
| InChIKey | XTHAQUKMKBYPSP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |