C16H22Cl2 — CID 21025309
1,2-dichloro-4-[(4-propan-2-ylcyclohexyl)methyl]benzene (PubChem CID 21025309) has the molecular formula C16H22Cl2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1,2-dichloro-4-[(4-propan-2-ylcyclohexyl)methyl]benzene.
| Compound Name | 1,2-dichloro-4-[(4-propan-2-ylcyclohexyl)methyl]benzene |
|---|---|
| PubChem CID | 21025309 |
| Molecular Formula | C16H22Cl2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1,2-dichloro-4-[(4-propan-2-ylcyclohexyl)methyl]benzene |
| SMILES | CC(C)C1CCC(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H22Cl2/c1-11(2)14-6-3-12(4-7-14)9-13-5-8-15(17)16(18)10-13/h5,8,10-12,14H,3-4,6-7,9H2,1-2H3 |
| InChIKey | COGVMCLKKSUMQD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |