C18H27Cl2N — CID 63527651
1-(4-butylcyclohexyl)-2-(3,4-dichlorophenyl)ethanamine (PubChem CID 63527651) has the molecular formula C18H27Cl2N and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-2-(3,4-dichlorophenyl)ethanamine.
| Compound Name | 1-(4-butylcyclohexyl)-2-(3,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 63527651 |
| Molecular Formula | C18H27Cl2N |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-(4-butylcyclohexyl)-2-(3,4-dichlorophenyl)ethanamine |
| SMILES | CCCCC1CCC(C(N)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H27Cl2N/c1-2-3-4-13-5-8-15(9-6-13)18(21)12-14-7-10-16(19)17(20)11-14/h7,10-11,13,15,18H,2-6,8-9,12,21H2,1H3 |
| InChIKey | OMIWLNQTKIPQCD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |