C16H23Cl2N — CID 64739450
2-(3,4-dichlorophenyl)-1-(3,4-dimethylcyclohexyl)ethanamine (PubChem CID 64739450) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(3,4-dimethylcyclohexyl)ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(3,4-dimethylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 64739450 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(3,4-dimethylcyclohexyl)ethanamine |
| SMILES | CC1CCC(C(N)Cc2ccc(Cl)c(Cl)c2)CC1C |
| InChI | InChI=1S/C16H23Cl2N/c1-10-3-5-13(7-11(10)2)16(19)9-12-4-6-14(17)15(18)8-12/h4,6,8,10-11,13,16H,3,5,7,9,19H2,1-2H3 |
| InChIKey | QPHMFMKAMHZANV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |