C15H21ClFN — CID 114025177
(4-chloro-3-fluorophenyl)-(3,4-dimethylcyclohexyl)methanamine (PubChem CID 114025177) has the molecular formula C15H21ClFN and a molecular weight of 269.79 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl)-(3,4-dimethylcyclohexyl)methanamine.
| Compound Name | (4-chloro-3-fluorophenyl)-(3,4-dimethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 114025177 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (4-chloro-3-fluorophenyl)-(3,4-dimethylcyclohexyl)methanamine |
| SMILES | CC1CCC(C(N)c2ccc(Cl)c(F)c2)CC1C |
| InChI | InChI=1S/C15H21ClFN/c1-9-3-4-11(7-10(9)2)15(18)12-5-6-13(16)14(17)8-12/h5-6,8-11,15H,3-4,7,18H2,1-2H3 |
| InChIKey | KHSSXYAAEIQFQG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |