C10H12ClF2N — CID 171229648
(S)-cyclopropyl-(3,4-difluorophenyl)methanamine;hydrochloride (PubChem CID 171229648) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is (S)-cyclopropyl-(3,4-difluorophenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclopropyl-(3,4-difluorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171229648 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (S)-cyclopropyl-(3,4-difluorophenyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C10H11F2N.ClH/c11-8-4-3-7(5-9(8)12)10(13)6-1-2-6;/h3-6,10H,1-2,13H2;1H/t10-;/m0./s1 |
| InChIKey | TVKYGZGOIGFKIR-PPHPATTJSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |