C13H19ClFNO — CID 171247844
(R)-(3-fluoro-4-methylphenyl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171247844) has the molecular formula C13H19ClFNO and a molecular weight of 259.75 g/mol. Its IUPAC name is (R)-(3-fluoro-4-methylphenyl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (R)-(3-fluoro-4-methylphenyl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171247844 |
| Molecular Formula | C13H19ClFNO |
| Molecular Weight | 259.75 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (R)-(3-fluoro-4-methylphenyl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)C2CCOCC2)cc1F.Cl |
| InChI | InChI=1S/C13H18FNO.ClH/c1-9-2-3-11(8-12(9)14)13(15)10-4-6-16-7-5-10;/h2-3,8,10,13H,4-7,15H2,1H3;1H/t13-;/m1./s1 |
| InChIKey | DWPVGYXYSROKRS-BTQNPOSSSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |