C13H16ClF4NO — CID 171249564
(R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171249564) has the molecular formula C13H16ClF4NO and a molecular weight of 313.72 g/mol. Its IUPAC name is (R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171249564 |
| Molecular Formula | C13H16ClF4NO |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (R)-[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(C(F)(F)F)c(F)c1)C1CCOCC1 |
| InChI | InChI=1S/C13H15F4NO.ClH/c14-11-7-9(1-2-10(11)13(15,16)17)12(18)8-3-5-19-6-4-8;/h1-2,7-8,12H,3-6,18H2;1H/t12-;/m1./s1 |
| InChIKey | BLHKYEFSUVAEDB-UTONKHPSSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |