C15H19F4NO — CID 107289016
N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]ethanamine (PubChem CID 107289016) has the molecular formula C15H19F4NO and a molecular weight of 305.31 g/mol. Its IUPAC name is N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]ethanamine.
| Compound Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107289016 |
| Molecular Formula | C15H19F4NO |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(C(F)(F)F)c(F)c1)C1CCOCC1 |
| InChI | InChI=1S/C15H19F4NO/c1-2-20-14(10-5-7-21-8-6-10)11-3-4-12(13(16)9-11)15(17,18)19/h3-4,9-10,14,20H,2,5-8H2,1H3 |
| InChIKey | QYPFSQDYBDCKPO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |