C15H19F4NS — CID 107291699
N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(thiolan-3-yl)methyl]propan-1-amine (PubChem CID 107291699) has the molecular formula C15H19F4NS and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(thiolan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(thiolan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107291699 |
| Molecular Formula | C15H19F4NS |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]-(thiolan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C(F)(F)F)c(F)c1)C1CCSC1 |
| InChI | InChI=1S/C15H19F4NS/c1-2-6-20-14(11-5-7-21-9-11)10-3-4-12(13(16)8-10)15(17,18)19/h3-4,8,11,14,20H,2,5-7,9H2,1H3 |
| InChIKey | WJHGLQPLQVGKEF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |