C15H20F3NOS — CID 105145863
N-[thiolan-3-yl-[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine (PubChem CID 105145863) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[thiolan-3-yl-[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[thiolan-3-yl-[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105145863 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[thiolan-3-yl-[3-(trifluoromethoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(OC(F)(F)F)c1)C1CCSC1 |
| InChI | InChI=1S/C15H20F3NOS/c1-2-7-19-14(12-6-8-21-10-12)11-4-3-5-13(9-11)20-15(16,17)18/h3-5,9,12,14,19H,2,6-8,10H2,1H3 |
| InChIKey | XWVDKKPMWLFPBF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |