C15H19F4N — CID 107289047
N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]propan-1-amine (PubChem CID 107289047) has the molecular formula C15H19F4N and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]propan-1-amine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107289047 |
| Molecular Formula | C15H19F4N |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(F)c(C(F)(F)F)c1)C1CC1C |
| InChI | InChI=1S/C15H19F4N/c1-3-6-20-14(11-7-9(11)2)10-4-5-13(16)12(8-10)15(17,18)19/h4-5,8-9,11,14,20H,3,6-7H2,1-2H3 |
| InChIKey | CCEOBBBXVMFUEK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |