C12H14F4N2 — CID 107292329
[[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]hydrazine (PubChem CID 107292329) has the molecular formula C12H14F4N2 and a molecular weight of 262.25 g/mol. Its IUPAC name is [[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]hydrazine.
| Compound Name | [[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107292329 |
| Molecular Formula | C12H14F4N2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [[4-fluoro-3-(trifluoromethyl)phenyl]-(2-methylcyclopropyl)methyl]hydrazine |
| SMILES | CC1CC1C(NN)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F4N2/c1-6-4-8(6)11(18-17)7-2-3-10(13)9(5-7)12(14,15)16/h2-3,5-6,8,11,18H,4,17H2,1H3 |
| InChIKey | APPDDDLEHNRUAV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|