C12H16F4N2 — CID 105325763
[1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methylbutyl]hydrazine (PubChem CID 105325763) has the molecular formula C12H16F4N2 and a molecular weight of 264.27 g/mol. Its IUPAC name is [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methylbutyl]hydrazine.
| Compound Name | [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 105325763 |
| Molecular Formula | C12H16F4N2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-methylbutyl]hydrazine |
| SMILES | CCC(C)C(NN)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F4N2/c1-3-7(2)11(18-17)8-4-5-10(13)9(6-8)12(14,15)16/h4-7,11,18H,3,17H2,1-2H3 |
| InChIKey | LBINWRVWHWFPSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|