C11H13F4NO — CID 171159873
(1R,2S)-1-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 171159873) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 171159873 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (1R,2S)-1-amino-1-[4-fluoro-3-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | CC[C@H](O)[C@H](N)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F4NO/c1-2-9(17)10(16)6-3-4-8(12)7(5-6)11(13,14)15/h3-5,9-10,17H,2,16H2,1H3/t9-,10+/m0/s1 |
| InChIKey | BQXZBTFDHZKUAD-VHSXEESVSA-N |
| XLogP | 2.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |