C10H14FNO2 — CID 131131076
4-[(1R,2S)-1-amino-2-hydroxybutyl]-2-fluorophenol (PubChem CID 131131076) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxybutyl]-2-fluorophenol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxybutyl]-2-fluorophenol |
|---|---|
| PubChem CID | 131131076 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxybutyl]-2-fluorophenol |
| SMILES | CC[C@H](O)[C@H](N)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C10H14FNO2/c1-2-8(13)10(12)6-3-4-9(14)7(11)5-6/h3-5,8,10,13-14H,2,12H2,1H3/t8-,10+/m0/s1 |
| InChIKey | MBAPZHXYQQDIRP-WCBMZHEXSA-N |
| XLogP | 1.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |