C8H8F3NO — CID 130700955
4-[(1R)-1-amino-2,2-difluoroethyl]-2-fluorophenol (PubChem CID 130700955) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2,2-difluoroethyl]-2-fluorophenol.
| Compound Name | 4-[(1R)-1-amino-2,2-difluoroethyl]-2-fluorophenol |
|---|---|
| PubChem CID | 130700955 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4-[(1R)-1-amino-2,2-difluoroethyl]-2-fluorophenol |
| SMILES | N[C@H](c1ccc(O)c(F)c1)C(F)F |
| InChI | InChI=1S/C8H8F3NO/c9-5-3-4(1-2-6(5)13)7(12)8(10)11/h1-3,7-8,13H,12H2/t7-/m1/s1 |
| InChIKey | RHAIWQUZBGCUFZ-SSDOTTSWSA-N |
| XLogP | 1.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |