C10H13F2NO — CID 130150345
1-amino-1-(3,5-difluorophenyl)butan-2-ol (PubChem CID 130150345) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-amino-1-(3,5-difluorophenyl)butan-2-ol.
| Compound Name | 1-amino-1-(3,5-difluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 130150345 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-amino-1-(3,5-difluorophenyl)butan-2-ol |
| SMILES | CCC(O)C(N)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H13F2NO/c1-2-9(14)10(13)6-3-7(11)5-8(12)4-6/h3-5,9-10,14H,2,13H2,1H3 |
| InChIKey | YEZYHBGSKKSTLK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |