C12H16F2O — CID 105407726
1-(3,5-difluorophenyl)-2-methylpentan-3-ol (PubChem CID 105407726) has the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-methylpentan-3-ol.
| Compound Name | 1-(3,5-difluorophenyl)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 105407726 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-methylpentan-3-ol |
| SMILES | CCC(O)C(C)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2O/c1-3-12(15)8(2)4-9-5-10(13)7-11(14)6-9/h5-8,12,15H,3-4H2,1-2H3 |
| InChIKey | IRWUIAZBYHHAGZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |