C11H14F2O — CID 105410784
2-[(3,5-difluorophenyl)methyl]butan-1-ol (PubChem CID 105410784) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]butan-1-ol.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 105410784 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]butan-1-ol |
| SMILES | CCC(CO)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H14F2O/c1-2-8(7-14)3-9-4-10(12)6-11(13)5-9/h4-6,8,14H,2-3,7H2,1H3 |
| InChIKey | LGOZYTICQYUBPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |