C12H16F2O2 — CID 103454783
1-(3,5-difluorophenyl)hexane-2,3-diol (PubChem CID 103454783) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)hexane-2,3-diol.
| Compound Name | 1-(3,5-difluorophenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 103454783 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-(3,5-difluorophenyl)hexane-2,3-diol |
| SMILES | CCCC(O)C(O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2O2/c1-2-3-11(15)12(16)6-8-4-9(13)7-10(14)5-8/h4-5,7,11-12,15-16H,2-3,6H2,1H3 |
| InChIKey | WWDRZWULKYYSJI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |