C12H18O2 — CID 68731092
1-phenylhexane-2,3-diol (PubChem CID 68731092) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-phenylhexane-2,3-diol.
| Compound Name | 1-phenylhexane-2,3-diol |
|---|---|
| PubChem CID | 68731092 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-phenylhexane-2,3-diol |
| SMILES | CCCC(O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C12H18O2/c1-2-6-11(13)12(14)9-10-7-4-3-5-8-10/h3-5,7-8,11-14H,2,6,9H2,1H3 |
| InChIKey | JJEDCCCWPIOSQL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |