C13H20O3 — CID 91525672
1-(4-hydroxyphenyl)heptane-2,3-diol (PubChem CID 91525672) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)heptane-2,3-diol.
| Compound Name | 1-(4-hydroxyphenyl)heptane-2,3-diol |
|---|---|
| PubChem CID | 91525672 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-(4-hydroxyphenyl)heptane-2,3-diol |
| SMILES | CCCCC(O)C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H20O3/c1-2-3-4-12(15)13(16)9-10-5-7-11(14)8-6-10/h5-8,12-16H,2-4,9H2,1H3 |
| InChIKey | YWKHWJXROTUADT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |