C15H22Br2O — CID 14832357
4-(2,6-dibromononyl)phenol (PubChem CID 14832357) has the molecular formula C15H22Br2O and a molecular weight of 378.15 g/mol. Its IUPAC name is 4-(2,6-dibromononyl)phenol.
| Compound Name | 4-(2,6-dibromononyl)phenol |
|---|---|
| PubChem CID | 14832357 |
| Molecular Formula | C15H22Br2O |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 4-(2,6-dibromononyl)phenol |
| SMILES | CCCC(Br)CCCC(Br)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H22Br2O/c1-2-4-13(16)5-3-6-14(17)11-12-7-9-15(18)10-8-12/h7-10,13-14,18H,2-6,11H2,1H3 |
| InChIKey | QHXKPTQRIQGAHI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|