About 2-bromotridecylbenzene
2-bromotridecylbenzene (PubChem CID 65427778) has the molecular formula C19H31Br
and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-bromotridecylbenzene.
Molecular Properties
| Compound Name | 2-bromotridecylbenzene |
| PubChem CID | 65427778 |
| Molecular Formula | C19H31Br |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-bromotridecylbenzene |
| SMILES | CCCCCCCCCCCC(Br)Cc1ccccc1 |
| InChI | InChI=1S/C19H31Br/c1-2-3-4-5-6-7-8-9-13-16-19(20)17-18-14-11-10-12-15-18/h10-12,14-15,19H,2-9,13,16-17H2,1H3 |
| InChIKey | GGOMDYNPYOSQEP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromotridecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromotridecylbenzene?
The IUPAC name of 2-bromotridecylbenzene (CID 65427778) is 2-bromotridecylbenzene.
What is the SMILES notation for 2-bromotridecylbenzene?
The canonical SMILES for 2-bromotridecylbenzene is CCCCCCCCCCCC(Br)Cc1ccccc1.
What is the InChIKey of 2-bromotridecylbenzene?
The InChIKey is GGOMDYNPYOSQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31Br/c1-2-3-4-5-6-7-8-9-13-16-19(20)17-18-14-11-10-12-15-18/h10-12,14-15,19H,2-9,13,16-17H2,1H3.
What are the key properties of 2-bromotridecylbenzene?
2-bromotridecylbenzene has a molecular weight of 339.36 g/mol, XLogP of 6.91, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromotridecylbenzene is sourced from PubChem (CID 65427778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).