About hydrogen peroxide;2-methyldodecylbenzene
hydrogen peroxide;2-methyldodecylbenzene (PubChem CID 159185106) has the molecular formula C19H34O2
and a molecular weight of 294.48 g/mol. Its IUPAC name is hydrogen peroxide;2-methyldodecylbenzene.
Molecular Properties
| Compound Name | hydrogen peroxide;2-methyldodecylbenzene |
| PubChem CID | 159185106 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | hydrogen peroxide;2-methyldodecylbenzene |
| SMILES | CCCCCCCCCCC(C)Cc1ccccc1.OO |
| InChI | InChI=1S/C19H32.H2O2/c1-3-4-5-6-7-8-9-11-14-18(2)17-19-15-12-10-13-16-19;1-2/h10,12-13,15-16,18H,3-9,11,14,17H2,1-2H3;1-2H |
| InChIKey | KNJRVOWGRUCFAD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;2-methyldodecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;2-methyldodecylbenzene?
The IUPAC name of hydrogen peroxide;2-methyldodecylbenzene (CID 159185106) is hydrogen peroxide;2-methyldodecylbenzene.
What is the SMILES notation for hydrogen peroxide;2-methyldodecylbenzene?
The canonical SMILES for hydrogen peroxide;2-methyldodecylbenzene is CCCCCCCCCCC(C)Cc1ccccc1.OO.
What is the InChIKey of hydrogen peroxide;2-methyldodecylbenzene?
The InChIKey is KNJRVOWGRUCFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32.H2O2/c1-3-4-5-6-7-8-9-11-14-18(2)17-19-15-12-10-13-16-19;1-2/h10,12-13,15-16,18H,3-9,11,14,17H2,1-2H3;1-2H.
What are the key properties of hydrogen peroxide;2-methyldodecylbenzene?
hydrogen peroxide;2-methyldodecylbenzene has a molecular weight of 294.48 g/mol, XLogP of 6.41, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;2-methyldodecylbenzene is sourced from PubChem (CID 159185106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).