About 2-methyldecyl 2-benzyloctanoate
2-methyldecyl 2-benzyloctanoate (PubChem CID 138503923) has the molecular formula C26H44O2
and a molecular weight of 388.64 g/mol. Its IUPAC name is 2-methyldecyl 2-benzyloctanoate.
Molecular Properties
| Compound Name | 2-methyldecyl 2-benzyloctanoate |
| PubChem CID | 138503923 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 2-methyldecyl 2-benzyloctanoate |
| SMILES | CCCCCCCCC(C)COC(=O)C(CCCCCC)Cc1ccccc1 |
| InChI | InChI=1S/C26H44O2/c1-4-6-8-10-11-13-17-23(3)22-28-26(27)25(20-16-9-7-5-2)21-24-18-14-12-15-19-24/h12,14-15,18-19,23,25H,4-11,13,16-17,20-22H2,1-3H3 |
| InChIKey | IGDRPEGQVUSUGN-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldecyl 2-benzyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldecyl 2-benzyloctanoate?
The IUPAC name of 2-methyldecyl 2-benzyloctanoate (CID 138503923) is 2-methyldecyl 2-benzyloctanoate.
What is the SMILES notation for 2-methyldecyl 2-benzyloctanoate?
The canonical SMILES for 2-methyldecyl 2-benzyloctanoate is CCCCCCCCC(C)COC(=O)C(CCCCCC)Cc1ccccc1.
What is the InChIKey of 2-methyldecyl 2-benzyloctanoate?
The InChIKey is IGDRPEGQVUSUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H44O2/c1-4-6-8-10-11-13-17-23(3)22-28-26(27)25(20-16-9-7-5-2)21-24-18-14-12-15-19-24/h12,14-15,18-19,23,25H,4-11,13,16-17,20-22H2,1-3H3.
What are the key properties of 2-methyldecyl 2-benzyloctanoate?
2-methyldecyl 2-benzyloctanoate has a molecular weight of 388.64 g/mol, XLogP of 7.75, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldecyl 2-benzyloctanoate is sourced from PubChem (CID 138503923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).