About bis(2-ethylhexyl) 2-benzylhexanedioate
bis(2-ethylhexyl) 2-benzylhexanedioate (PubChem CID 140633299) has the molecular formula C29H48O4
and a molecular weight of 460.70 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-benzylhexanedioate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) 2-benzylhexanedioate |
| PubChem CID | 140633299 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | bis(2-ethylhexyl) 2-benzylhexanedioate |
| SMILES | CCCCC(CC)COC(=O)CCCC(Cc1ccccc1)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C29H48O4/c1-5-9-15-24(7-3)22-32-28(30)20-14-19-27(21-26-17-12-11-13-18-26)29(31)33-23-25(8-4)16-10-6-2/h11-13,17-18,24-25,27H,5-10,14-16,19-23H2,1-4H3 |
| InChIKey | OVTFOGCBXDTJQS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-ethylhexyl) 2-benzylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) 2-benzylhexanedioate?
The IUPAC name of bis(2-ethylhexyl) 2-benzylhexanedioate (CID 140633299) is bis(2-ethylhexyl) 2-benzylhexanedioate.
What is the SMILES notation for bis(2-ethylhexyl) 2-benzylhexanedioate?
The canonical SMILES for bis(2-ethylhexyl) 2-benzylhexanedioate is CCCCC(CC)COC(=O)CCCC(Cc1ccccc1)C(=O)OCC(CC)CCCC.
What is the InChIKey of bis(2-ethylhexyl) 2-benzylhexanedioate?
The InChIKey is OVTFOGCBXDTJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H48O4/c1-5-9-15-24(7-3)22-32-28(30)20-14-19-27(21-26-17-12-11-13-18-26)29(31)33-23-25(8-4)16-10-6-2/h11-13,17-18,24-25,27H,5-10,14-16,19-23H2,1-4H3.
What are the key properties of bis(2-ethylhexyl) 2-benzylhexanedioate?
bis(2-ethylhexyl) 2-benzylhexanedioate has a molecular weight of 460.70 g/mol, XLogP of 7.53, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) 2-benzylhexanedioate is sourced from PubChem (CID 140633299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).