C32H60O6 — CID 124824126
1-O,3-O-bis[(2R)-2-ethylhexyl] 5-O-[(2S)-2-ethylhexyl] pentane-1,3,5-tricarboxylate (PubChem CID 124824126) has the molecular formula C32H60O6 and a molecular weight of 540.83 g/mol. Its IUPAC name is 1-O,3-O-bis[(2R)-2-ethylhexyl] 5-O-[(2S)-2-ethylhexyl] pentane-1,3,5-tricarboxylate.
| Compound Name | 1-O,3-O-bis[(2R)-2-ethylhexyl] 5-O-[(2S)-2-ethylhexyl] pentane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 124824126 |
| Molecular Formula | C32H60O6 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | 1-O,3-O-bis[(2R)-2-ethylhexyl] 5-O-[(2S)-2-ethylhexyl] pentane-1,3,5-tricarboxylate |
| SMILES | CCCCC(CC)COC(=O)CCC(CCC(=O)OC[C@H](CC)CCCC)C(=O)OC[C@H](CC)CCCC |
| InChI | InChI=1S/C32H60O6/c1-7-13-16-26(10-4)23-36-30(33)21-19-29(32(35)38-25-28(12-6)18-15-9-3)20-22-31(34)37-24-27(11-5)17-14-8-2/h26-29H,7-25H2,1-6H3/t26-,27?,28-,29?/m1/s1 |
| InChIKey | DTEJTNWLYJARIR-WIQXCWHSSA-N |
| XLogP | 8.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|