About ethane;2-methylheptylbenzene
ethane;2-methylheptylbenzene (PubChem CID 142204161) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is ethane;2-methylheptylbenzene.
Molecular Properties
| Compound Name | ethane;2-methylheptylbenzene |
| PubChem CID | 142204161 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | ethane;2-methylheptylbenzene |
| SMILES | CC.CCCCCC(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H22.C2H6/c1-3-4-6-9-13(2)12-14-10-7-5-8-11-14;1-2/h5,7-8,10-11,13H,3-4,6,9,12H2,1-2H3;1-2H3 |
| InChIKey | WUGQLXNCUMSFSI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylheptylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylheptylbenzene?
The IUPAC name of ethane;2-methylheptylbenzene (CID 142204161) is ethane;2-methylheptylbenzene.
What is the SMILES notation for ethane;2-methylheptylbenzene?
The canonical SMILES for ethane;2-methylheptylbenzene is CC.CCCCCC(C)Cc1ccccc1.
What is the InChIKey of ethane;2-methylheptylbenzene?
The InChIKey is WUGQLXNCUMSFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C2H6/c1-3-4-6-9-13(2)12-14-10-7-5-8-11-14;1-2/h5,7-8,10-11,13H,3-4,6,9,12H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methylheptylbenzene?
ethane;2-methylheptylbenzene has a molecular weight of 220.40 g/mol, XLogP of 5.47, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylheptylbenzene is sourced from PubChem (CID 142204161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).