C29H46 — CID 174049605
2-methylheptylbenzene;2-methyloctylbenzene (PubChem CID 174049605) has the molecular formula C29H46 and a molecular weight of 394.69 g/mol. Its IUPAC name is 2-methylheptylbenzene;2-methyloctylbenzene.
| Compound Name | 2-methylheptylbenzene;2-methyloctylbenzene |
|---|---|
| PubChem CID | 174049605 |
| Molecular Formula | C29H46 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 2-methylheptylbenzene;2-methyloctylbenzene |
| SMILES | CCCCCC(C)Cc1ccccc1.CCCCCCC(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H24.C14H22/c1-3-4-5-7-10-14(2)13-15-11-8-6-9-12-15;1-3-4-6-9-13(2)12-14-10-7-5-8-11-14/h6,8-9,11-12,14H,3-5,7,10,13H2,1-2H3;5,7-8,10-11,13H,3-4,6,9,12H2,1-2H3 |
| InChIKey | IWWLMELSPRVGED-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|