C21H36O2 — CID 98091747
(2S,5S)-1-phenylpentadecane-2,5-diol (PubChem CID 98091747) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (2S,5S)-1-phenylpentadecane-2,5-diol.
| Compound Name | (2S,5S)-1-phenylpentadecane-2,5-diol |
|---|---|
| PubChem CID | 98091747 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (2S,5S)-1-phenylpentadecane-2,5-diol |
| SMILES | CCCCCCCCCC[C@H](O)CC[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-12-15-20(22)16-17-21(23)18-19-13-10-9-11-14-19/h9-11,13-14,20-23H,2-8,12,15-18H2,1H3/t20-,21-/m0/s1 |
| InChIKey | WYVJMQCITBRSFF-SFTDATJTSA-N |
| XLogP | 5.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|