C15H21F3O — CID 65149077
1-[3-(trifluoromethyl)phenyl]octan-2-ol (PubChem CID 65149077) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]octan-2-ol.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]octan-2-ol |
|---|---|
| PubChem CID | 65149077 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]octan-2-ol |
| SMILES | CCCCCCC(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3O/c1-2-3-4-5-9-14(19)11-12-7-6-8-13(10-12)15(16,17)18/h6-8,10,14,19H,2-5,9,11H2,1H3 |
| InChIKey | GSYLZQWRXIWPTH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|