C14H19F3O — CID 64513695
1-[3-(trifluoromethyl)phenyl]heptan-4-ol (PubChem CID 64513695) has the molecular formula C14H19F3O and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]heptan-4-ol.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]heptan-4-ol |
|---|---|
| PubChem CID | 64513695 |
| Molecular Formula | C14H19F3O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]heptan-4-ol |
| SMILES | CCCC(O)CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3O/c1-2-5-13(18)9-4-7-11-6-3-8-12(10-11)14(15,16)17/h3,6,8,10,13,18H,2,4-5,7,9H2,1H3 |
| InChIKey | DQRSKHCTNAIXIO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |