C11H15F3O3Si — CID 162546346
3-[3-(trifluoromethyl)phenyl]propylsilyloxymethanediol (PubChem CID 162546346) has the molecular formula C11H15F3O3Si and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]propylsilyloxymethanediol.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]propylsilyloxymethanediol |
|---|---|
| PubChem CID | 162546346 |
| Molecular Formula | C11H15F3O3Si |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]propylsilyloxymethanediol |
| SMILES | OC(O)O[SiH2]CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3O3Si/c12-11(13,14)9-5-1-3-8(7-9)4-2-6-18-17-10(15)16/h1,3,5,7,10,15-16H,2,4,6,18H2 |
| InChIKey | GWUSWGAJWUPTRN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|