C10H10F6O3Si — CID 154058713
[3,5-bis(trifluoromethyl)phenyl]methylsilyloxymethanediol (PubChem CID 154058713) has the molecular formula C10H10F6O3Si and a molecular weight of 320.26 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methylsilyloxymethanediol.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methylsilyloxymethanediol |
|---|---|
| PubChem CID | 154058713 |
| Molecular Formula | C10H10F6O3Si |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methylsilyloxymethanediol |
| SMILES | OC(O)O[SiH2]Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F6O3Si/c11-9(12,13)6-1-5(4-20-19-8(17)18)2-7(3-6)10(14,15)16/h1-3,8,17-18H,4,20H2 |
| InChIKey | WTUKFENYULPEQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|