C19H12F12O — CID 172768218
1,2-bis[3,5-bis(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 172768218) has the molecular formula C19H12F12O and a molecular weight of 484.28 g/mol. Its IUPAC name is 1,2-bis[3,5-bis(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1,2-bis[3,5-bis(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 172768218 |
| Molecular Formula | C19H12F12O |
| Molecular Weight | 484.28 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 1,2-bis[3,5-bis(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC(O)(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F12O/c1-15(32,10-4-13(18(26,27)28)7-14(5-10)19(29,30)31)8-9-2-11(16(20,21)22)6-12(3-9)17(23,24)25/h2-7,32H,8H2,1H3 |
| InChIKey | MPGQJSYLELLGMX-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.28 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |