C12H8F6O5 — CID 139684663
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-hydroxypropanedioic acid (PubChem CID 139684663) has the molecular formula C12H8F6O5 and a molecular weight of 346.18 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-hydroxypropanedioic acid.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-hydroxypropanedioic acid |
|---|---|
| PubChem CID | 139684663 |
| Molecular Formula | C12H8F6O5 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-hydroxypropanedioic acid |
| SMILES | O=C(O)C(O)(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H8F6O5/c13-11(14,15)6-1-5(2-7(3-6)12(16,17)18)4-10(23,8(19)20)9(21)22/h1-3,23H,4H2,(H,19,20)(H,21,22) |
| InChIKey | CKSQZGBLQSMTNI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|