C12H12ClF6NO2S — CID 46838904
(2R)-2-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-sulfanylpropanoic acid;hydrochloride (PubChem CID 46838904) has the molecular formula C12H12ClF6NO2S and a molecular weight of 383.74 g/mol. Its IUPAC name is (2R)-2-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-sulfanylpropanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-sulfanylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 46838904 |
| Molecular Formula | C12H12ClF6NO2S |
| Molecular Weight | 383.74 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | (2R)-2-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-sulfanylpropanoic acid;hydrochloride |
| SMILES | Cl.N[C@](CS)(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H11F6NO2S.ClH/c13-11(14,15)7-1-6(2-8(3-7)12(16,17)18)4-10(19,5-22)9(20)21;/h1-3,22H,4-5,19H2,(H,20,21);1H/t10-;/m0./s1 |
| InChIKey | GYVRNAJANMZERQ-PPHPATTJSA-N |
| XLogP | 3.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|