C12H12F6N2O — CID 130381501
N-(2-aminoethyl)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 130381501) has the molecular formula C12H12F6N2O and a molecular weight of 314.23 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 130381501 |
| Molecular Formula | C12H12F6N2O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(2-aminoethyl)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | NCCNC(=O)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6N2O/c13-11(14,15)8-3-7(5-10(21)20-2-1-19)4-9(6-8)12(16,17)18/h3-4,6H,1-2,5,19H2,(H,20,21) |
| InChIKey | KGASBHVUJNRXJD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |