About N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide
N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 158741850) has the molecular formula C15H22F3N3O
and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 158741850 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc(CC(=O)NC[C@@H](N)CCCN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3N3O/c1-10-5-11(7-12(6-10)15(16,17)18)8-14(22)21-9-13(20)3-2-4-19/h5-7,13H,2-4,8-9,19-20H2,1H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | MPRJSDXHXPQJQQ-ZDUSSCGKSA-N |
| XLogP | 1.74 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide (CID 158741850) is N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide is Cc1cc(CC(=O)NC[C@@H](N)CCCN)cc(C(F)(F)F)c1.
What is the InChIKey of N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide?
The InChIKey is MPRJSDXHXPQJQQ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H22F3N3O/c1-10-5-11(7-12(6-10)15(16,17)18)8-14(22)21-9-13(20)3-2-4-19/h5-7,13H,2-4,8-9,19-20H2,1H3,(H,21,22)/t13-/m0/s1.
What are the key properties of N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide?
N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide has a molecular weight of 317.36 g/mol, XLogP of 1.74, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2,5-diaminopentyl]-2-[3-methyl-5-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 158741850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).