C20H25N5O — CID 157297296
N-[(2S)-2,5-diaminopentyl]-6-(4-methylphenyl)-1H-benzimidazole-2-carboxamide (PubChem CID 157297296) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[(2S)-2,5-diaminopentyl]-6-(4-methylphenyl)-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[(2S)-2,5-diaminopentyl]-6-(4-methylphenyl)-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 157297296 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[(2S)-2,5-diaminopentyl]-6-(4-methylphenyl)-1H-benzimidazole-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc3nc(C(=O)NC[C@@H](N)CCCN)[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-13-4-6-14(7-5-13)15-8-9-17-18(11-15)25-19(24-17)20(26)23-12-16(22)3-2-10-21/h4-9,11,16H,2-3,10,12,21-22H2,1H3,(H,23,26)(H,24,25)/t16-/m0/s1 |
| InChIKey | OQMARXZBVNSQHG-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |