C20H23ClN4O — CID 135324569
6-(4-chlorophenyl)-N-(2,5-diaminopentyl)-1H-indole-2-carboxamide (PubChem CID 135324569) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(2,5-diaminopentyl)-1H-indole-2-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-(2,5-diaminopentyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135324569 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(2,5-diaminopentyl)-1H-indole-2-carboxamide |
| SMILES | NCCCC(N)CNC(=O)c1cc2ccc(-c3ccc(Cl)cc3)cc2[nH]1 |
| InChI | InChI=1S/C20H23ClN4O/c21-16-7-5-13(6-8-16)14-3-4-15-11-19(25-18(15)10-14)20(26)24-12-17(23)2-1-9-22/h3-8,10-11,17,25H,1-2,9,12,22-23H2,(H,24,26) |
| InChIKey | LNKKNYKXUBPMNF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |