C21H25FN4O — CID 135324352
N-(2,5-diaminohexyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide (PubChem CID 135324352) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is N-(2,5-diaminohexyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(2,5-diaminohexyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135324352 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-(2,5-diaminohexyl)-6-(4-fluorophenyl)-1H-indole-2-carboxamide |
| SMILES | CC(N)CCC(N)CNC(=O)c1cc2ccc(-c3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C21H25FN4O/c1-13(23)2-9-18(24)12-25-21(27)20-11-16-4-3-15(10-19(16)26-20)14-5-7-17(22)8-6-14/h3-8,10-11,13,18,26H,2,9,12,23-24H2,1H3,(H,25,27) |
| InChIKey | DKZADVOHRVNCKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |